CAS 254877-67-3
:5-chloro-2-{[(5-chlorothiophen-2-yl)sulfonyl]amino}-N-[4-(morpholin-4-ylsulfonyl)phenyl]benzamide
Description:
5-chloro-2-{[(5-chlorothiophen-2-yl)sulfonyl]amino}-N-[4-(morpholin-4-ylsulfonyl)phenyl]benzamide is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups such as sulfonamides and amides. The presence of chlorine atoms and a thiophene ring contributes to its potential biological activity, making it of interest in medicinal chemistry. This compound is likely to exhibit properties such as moderate to high solubility in organic solvents, and it may have specific interactions with biological targets due to its structural features. The morpholine moiety suggests potential for interactions with biological systems, possibly influencing pharmacokinetics and pharmacodynamics. Its sulfonamide groups may enhance its stability and solubility in aqueous environments. As with many compounds of this nature, it is essential to consider its safety profile, including toxicity and environmental impact, during research and application. Overall, this compound represents a class of molecules that may have therapeutic potential, warranting further investigation into its biological effects and mechanisms of action.
Formula:C21H19Cl2N3O6S3
InChI:InChI=1/C21H19Cl2N3O6S3/c22-14-1-6-18(25-34(28,29)20-8-7-19(23)33-20)17(13-14)21(27)24-15-2-4-16(5-3-15)35(30,31)26-9-11-32-12-10-26/h1-8,13,25H,9-12H2,(H,24,27)
SMILES:c1cc(c(cc1Cl)C(=O)Nc1ccc(cc1)S(=O)(=O)N1CCOCC1)NS(=O)(=O)c1ccc(Cl)s1
Synonyms:- 5-chloro-2-(5-chlorothiophene-2-sulfonylamino)-N-(4-(morpholine-4-sulfonyl)phenyl)benzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
5-Chloro-2-(5-Chlorothiophene-2-Sulfonamido)-N-(4-(Morpholinosulfonyl)Phenyl)Benzamide
CAS:5-Chloro-2-(5-Chlorothiophene-2-Sulfonamido)-N-(4-(Morpholinosulfonyl)Phenyl)BenzamideFormula:C21H19Cl2N3O6S3Purity:≥98%Molecular weight:576.49Ataciguat
CAS:Ataciguat (HMR-1766) (HMR-1766) is a potent and specific soluble guanylate cyclase (sGC) activator.Formula:C21H19Cl2N3O6S3Purity:99.09%Color and Shape:SolidMolecular weight:576.49Ataciguat
CAS:Activator of soluble guanylyl cyclase (sGC) which stimulates cGMP production and is effective in cells under oxidative stress. Ataciguat stimulates the heme-free form of the sGC enzyme via the sGC N-terminus of β1-subunit. Ataciguat can promote vasorelaxation and hypotension by restoring or potentiating the nitric oxide (NO) signalling pathway.
Formula:C21H19Cl2N3O6S3Purity:Min. 95%Color and Shape:PowderMolecular weight:576.5 g/molAtaciguat
CAS:5-Chloro-2-(5-chlorothiophene-2-sulfonamido)-N-(4-(morpholinosulfonyl)phenyl)benzamideFormula:C21H19Cl2N3O6S3Purity:98%Molecular weight:576.49






