CymitQuimica logo

CAS 254878-95-0

:

Benzaldehyde, 3-fluoro-4-(methylsulfonyl)-

Description:
Benzaldehyde, 3-fluoro-4-(methylsulfonyl)-, is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with a fluorine atom and a methylsulfonyl group. The presence of the aldehyde functional group (-CHO) contributes to its reactivity, making it a useful intermediate in organic synthesis. The fluorine atom introduces unique electronic properties, potentially enhancing the compound's reactivity and influencing its interaction with biological systems. The methylsulfonyl group (-SO2CH3) adds to the compound's polarity, which can affect its solubility in various solvents. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its molecular structure allows for various applications, including use as a building block in the synthesis of pharmaceuticals and agrochemicals. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C8H7FO3S
InChI:InChI=1S/C8H7FO3S/c1-13(11,12)8-3-2-6(5-10)4-7(8)9/h2-5H,1H3
InChI key:ATFKDQOGYYWXIY-UHFFFAOYSA-N
SMILES:CS(=O)(=O)C1=C(C=C(C=C1)C=O)F
Found 4 products.