
CAS 254888-42-1
:(S)-2-((S)-2-Acetamido-4-phenylbutanamido)-4-methyl-N-((S)-1-(((S)-4-methyl-1-((R)-2-methyloxiran-2-yl)-1-oxopentan-2-yl)amino)-1-oxo-3-phenylpropan-2-yl)pentanamide
Description:
The chemical substance with the name "(S)-2-((S)-2-Acetamido-4-phenylbutanamido)-4-methyl-N-((S)-1-(((S)-4-methyl-1-((R)-2-methyloxiran-2-yl)-1-oxopentan-2-yl)amino)-1-oxo-3-phenylpropan-2-yl)pentanamide" and CAS number "254888-42-1" is a complex organic compound characterized by its multiple chiral centers and functional groups. This substance features amide linkages, which are indicative of its potential biological activity, particularly in pharmaceutical applications. The presence of acetamido and phenyl groups suggests that it may exhibit specific interactions with biological targets, possibly influencing its solubility and stability. The compound's stereochemistry, denoted by the (S) and (R) designations, plays a crucial role in its pharmacodynamics and pharmacokinetics, as stereoisomers can have significantly different biological effects. Additionally, the oxirane ring indicates potential reactivity, which may be relevant in synthetic applications or biological interactions. Overall, this compound's intricate structure suggests it may be of interest in medicinal chemistry and drug development.
Formula:C36H50N4O6
InChI:InChI=1S/C36H50N4O6/c1-23(2)19-29(32(42)36(6)22-46-36)38-35(45)31(21-27-15-11-8-12-16-27)40-34(44)30(20-24(3)4)39-33(43)28(37-25(5)41)18-17-26-13-9-7-10-14-26/h7-16,23-24,28-31H,17-22H2,1-6H3,(H,37,41)(H,38,45)(H,39,43)(H,40,44)/t28-,29-,30-,31-,36+/m0/s1
InChI key:AEKCYLCKBMCKDQ-KGSCVCOFSA-N
SMILES:CC(C)C[C@@H](C(=O)[C@]1(CO1)C)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC3=CC=CC=C3)NC(=O)C
Synonyms:- (S)-2-((S)-2-Acetamido-4-phenylbutanamido)-4-methyl-N-((S)-1-(((S)-4-methyl-1-((R)-2-methyloxiran-2-yl)-1-oxopentan-2-yl)amino)-1-oxo-3-phenylpropan-2-yl)pentanamide
- L-Phenylalaninamide, (αS)-α-(acetylamino)benzenebutanoyl-L-leucyl-N-[(1S)-3-methyl-1-[[(2R)-2-methyl-2-oxiranyl]carbonyl]butyl]-
- PR-019
- Kyprolis Impurity U
- Carfilzomib Impurity 57
- Carfilzomib Impurity U
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

