CAS 25499-90-5
:epi-Oleanolic acid
Description:
Epi-Oleanolic acid is a pentacyclic triterpenoid compound, structurally related to oleanolic acid, and is primarily found in various plants, particularly in the family Oleaceae. It exhibits a white to off-white crystalline appearance and is characterized by its molecular formula, which typically includes a significant number of carbon and hydrogen atoms, reflecting its triterpenoid nature. Epi-Oleanolic acid is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and hepatoprotective effects. It has been studied for its ability to modulate various biological pathways, making it of interest in medicinal chemistry and natural product research. The compound is soluble in organic solvents but has limited solubility in water, which is common for many triterpenoids. Its biological activities are attributed to its ability to interact with cellular signaling pathways, and ongoing research continues to explore its therapeutic potential in various health conditions. As with many natural compounds, the extraction and purification processes can influence its bioactivity and stability.
Formula:C30H48O3
InChI:InChI=1S/C30H48O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8,20-23,31H,9-18H2,1-7H3,(H,32,33)/t20-,21-,22+,23+,27-,28+,29+,30-/m0/s1
InChI key:InChIKey=MIJYXULNPSFWEK-KDQGZELNSA-N
SMILES:C[C@]12[C@@]3(C)C([C@]4([C@@](C(O)=O)(CC3)CCC(C)(C)C4)[H])=CC[C@@]1([C@]5(C)[C@@](CC2)(C(C)(C)[C@H](O)CC5)[H])[H]
Synonyms:- (3alpha)-3-Hydroxy-olean-12-en-28-oic acid
- (3α)-3-Hydroxyolean-12-en-28-oic acid
- 3-epi-Oleanolic acid
- 3α-Hydroxyolean-12-en-28-oic acid
- Epioleanolic acid
- Olean-12-en-28-oic acid, 3-hydroxy-, (3α)-
- Olean-12-en-28-oic acid, 3α-hydroxy-
- epi-Oleanolic acid
- 3-Epioleanolic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Epioleanolic acid
CAS:3-Epioleanolic and oleanonic acids are uterine muscle agonists; molecular tweaks alter their activity.Formula:C30H48O3Purity:98.36%Color and Shape:SolidMolecular weight:456.73-epi-Oleanolic Acid
CAS:Controlled ProductFormula:C30H48O3Color and Shape:NeatMolecular weight:456.73-Epioleanolic acid
CAS:Controlled Product3-Epioleanolic acid is a naturally occurring triterpenoid acid, which is derived from various plant sources, including the roots and leaves of certain medicinal plants. These sources are known for their rich composition of bioactive compounds. The mode of action of 3-Epioleanolic acid involves modulation of inflammatory pathways, where it has shown potential in inhibiting the production of pro-inflammatory cytokines and enzymes, thereby exerting anti-inflammatory effects at the molecular level.Formula:C30H48O3Purity:Min. 95%Molecular weight:456.7 g/mol






