CAS 25526-94-7: 3'-chloro-3'-deoxythymidine
Description:3'-Chloro-3'-deoxythymidine, also known as 3'-CldT, is a nucleoside analog of thymidine, characterized by the presence of a chlorine atom at the 3' position of the sugar moiety. This modification imparts unique properties to the compound, making it of interest in medicinal chemistry, particularly in antiviral and anticancer research. The absence of the hydroxyl group at the 3' position, combined with the chlorine substitution, affects its ability to participate in nucleic acid synthesis, potentially inhibiting viral replication or tumor growth. 3'-CldT exhibits moderate solubility in water and is typically stable under physiological conditions, although it may undergo hydrolysis or other reactions under certain circumstances. Its mechanism of action often involves incorporation into DNA, leading to chain termination during replication. As a result, 3'-chloro-3'-deoxythymidine has been studied for its potential therapeutic applications, particularly in the treatment of viral infections and certain types of cancer, although further research is necessary to fully understand its efficacy and safety profiles.
Formula:C10H13ClN2O4
InChI:InChI=1/C10H13ClN2O4/c1-5-3-13(10(16)12-9(5)15)8-2-6(11)7(4-14)17-8/h3,6-8,14H,2,4H2,1H3,(H,12,15,16)/t6-,7+,8+/m0/s1
