CAS 2555-28-4
:7-Methoxy-4-methylcoumarin
Description:
7-Methoxy-4-methylcoumarin, with the CAS number 2555-28-4, is a synthetic organic compound belonging to the coumarin family, which is characterized by a benzopyrone structure. This compound features a methoxy group at the 7-position and a methyl group at the 4-position of the coumarin ring, contributing to its unique chemical properties. It is typically a pale yellow to white crystalline solid with a characteristic sweet, floral odor. 7-Methoxy-4-methylcoumarin is known for its fluorescence properties, making it useful in various applications, including as a fluorescent marker in biochemical assays and as a potential ingredient in cosmetics due to its UV-absorbing capabilities. Additionally, it has been studied for its potential biological activities, including antioxidant and antimicrobial properties. The compound is soluble in organic solvents like ethanol and methanol but has limited solubility in water. As with many coumarins, it may exhibit phototoxicity under certain conditions, necessitating careful handling and usage in formulations.
Formula:C11H10O3
InChI:InChI=1S/C11H10O3/c1-7-5-11(12)14-10-6-8(13-2)3-4-9(7)10/h3-6H,1-2H3
InChI key:InChIKey=UDFPKNSWSYBIHO-UHFFFAOYSA-N
SMILES:CC=1C=2C(=CC(OC)=CC2)OC(=O)C1
Synonyms:- 2H-1-Benzopyran-2-one, 7-methoxy-4-methyl-
- 4-Methyl-7-methoxycoumarin
- 4-Methylherniarin
- 4-Methylumbelliferone methyl ether
- 7-Methoxy-4-methyl-2H-1-benzopyran-2-one
- 7-Methoxy-4-methyl-chromen-2-one
- 7-Methyloxy-4-methylcoumarin
- 7-methoxy-4-methyl-2H-chromen-2-one
- Coumarin, 7-methoxy-4-methyl-
- Herniarin, 4-methyl-
- Nsc 688805
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
7-Methoxy-4-methylcoumarin
CAS:Formula:C11H10O3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:190.207-methoxy-4-methyl-2H-chromen-2-one
CAS:Formula:C11H10O3Purity:95%Color and Shape:SolidMolecular weight:190.19534-Methylherniarin
CAS:4-Methylherniarin (7-Methoxy-4-methylcoumarin) is a coumarin derivative and fluorescent label, it displays good activity against B. subtilis.Formula:C11H10O3Purity:98.05%Color and Shape:SolidMolecular weight:190.27-Methoxy-4-methylcoumarin
CAS:7-Methoxy-4-methylcoumarinFormula:C11H10O3Purity:98%Color and Shape:Off-white SolidMolecular weight:190.19537-Methoxy-4-methylcoumarin
CAS:Applications 7-Methoxy-4-methylcoumarin (cas# 2555-28-4) is a compound useful in organic synthesis.
Formula:C11H10O3Color and Shape:NeatMolecular weight:190.27-Methoxy-4-methylcoumarin
CAS:7-Methoxy-4-methylcoumarin is a synthetic organic compound, which is a derivative of coumarins—a class of compounds widely found in plants. This compound is primarily synthesized through organic chemical reactions rather than extracted directly from natural sources. Its mode of action involves exhibiting fluorescence, which makes it a valuable probe in various scientific studies.Formula:C11H10O3Purity:Min. 95%Color and Shape:PowderMolecular weight:190.2 g/mol








