CymitQuimica logo

CAS 255723-98-9

:

(R)-N4-Benzyl-2-(benzyloxymethyl)piperazine

Description:
(R)-N4-Benzyl-2-(benzyloxymethyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a benzyl group and a benzyloxymethyl substituent, contributing to its structural complexity and potential biological activity. The presence of the chiral center at the piperazine nitrogen indicates that it can exist in two enantiomeric forms, with the (R) configuration being specified here. This stereochemistry can significantly influence the compound's pharmacological properties, including receptor binding and activity. The compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its solubility, stability, and reactivity can be influenced by the functional groups attached to the piperazine ring. Overall, (R)-N4-Benzyl-2-(benzyloxymethyl)piperazine is of interest in research contexts, particularly in the fields of drug design and synthesis.
Formula:C19H24N2O
InChI:InChI=1/C19H24N2O/c1-3-7-17(8-4-1)13-21-12-11-20-19(14-21)16-22-15-18-9-5-2-6-10-18/h1-10,19-20H,11-16H2/t19-/m1/s1
SMILES:c1ccc(cc1)CN1CCN[C@H](C1)COCc1ccccc1
Synonyms:
  • (3R)-1-benzyl-3-[(benzyloxy)methyl]piperazine
Found 1 products.