CymitQuimica logo

CAS 256376-68-8

:

1H-Pyrazolo[3,4-b]pyridine-3-carboximidamide,1-[(2-fluorophenyl)methyl]-

Description:
1H-Pyrazolo[3,4-b]pyridine-3-carboximidamide, 1-[(2-fluorophenyl)methyl]- is a chemical compound characterized by its unique pyrazolo-pyridine structure, which incorporates a carboximidamide functional group and a 2-fluorophenyl substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural features. It may be soluble in organic solvents and exhibit moderate stability under standard laboratory conditions. The presence of the fluorine atom in the phenyl group can influence its electronic properties, potentially enhancing lipophilicity and affecting its interaction with biological targets. Such compounds are often studied for their pharmacological potential, particularly in medicinal chemistry, where modifications to the core structure can lead to variations in activity and selectivity. As with many heterocycles, the synthesis and characterization of this compound would involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography. Safety data and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C14H12FN5
InChI:InChI=1S/C14H12FN5/c15-11-6-2-1-4-9(11)8-20-14-10(5-3-7-18-14)12(19-20)13(16)17/h1-7H,8H2,(H3,16,17)
InChI key:LQCFFAGUCURQEC-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)CN2C3=C(C=CC=N3)C(=N2)C(=N)N)F
Found 3 products.