CymitQuimica logo

CAS 2566-90-7

:

methyl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate

Description:
Methyl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate, commonly known as methyl docosahexaenoate, is a polyunsaturated fatty acid ester derived from docosahexaenoic acid (DHA). This compound features a long carbon chain with six double bonds, which are in the cis configuration, contributing to its fluidity and reactivity. It is typically found in marine oils and is known for its beneficial effects on human health, particularly in cardiovascular and neurological functions. Methyl docosahexaenoate is often used in dietary supplements and functional foods due to its omega-3 fatty acid content. Its chemical structure allows it to participate in various biochemical processes, including anti-inflammatory pathways. The compound is generally stable under normal conditions but may undergo oxidation if exposed to light, heat, or air, which can affect its nutritional properties. As a methyl ester, it is also soluble in organic solvents, making it useful in various industrial applications, including cosmetics and pharmaceuticals.
Formula:C23H34O2
InChI:InChI=1/C23H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25-2/h4-5,7-8,10-11,13-14,16-17,19-20H,3,6,9,12,15,18,21-22H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-
InChI key:VCDLWFYODNTQOT-JDPCYWKWSA-N
SMILES:CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC
Synonyms:
  • 4,7,10,13,16,19-docosahexaenoic acid, methyl ester, (4Z,7Z,10Z,13Z,16Z,19Z)-
  • 4,7,10,13,16,19-Docosahexaenoic acid, methyl ester, (all-Z)-
  • Methyl (4Z,7Z,10Z,13Z,16Z,19Z)-4,7,10,13,16,19-docosahexaenoate
Found 19 products.