CAS 25700-11-2
:2-(1H-Pyrazol-1-yl)pyridine
Description:
2-(1H-Pyrazol-1-yl)pyridine, with the CAS number 25700-11-2, is an organic compound characterized by its heterocyclic structure, which includes both a pyrazole and a pyridine ring. This compound typically exhibits properties such as being a pale yellow to off-white solid at room temperature. It is soluble in polar organic solvents like ethanol and dimethyl sulfoxide, but its solubility in water is limited. The presence of both nitrogen-containing rings contributes to its potential as a ligand in coordination chemistry, as well as its utility in medicinal chemistry due to possible biological activity. The compound may exhibit various functional properties, including the ability to participate in hydrogen bonding and coordination with metal ions. Its synthesis often involves the reaction of appropriate precursors under specific conditions, and it may be used in the development of pharmaceuticals or agrochemicals. As with many heterocycles, it may also display interesting electronic properties, making it a subject of study in materials science and organic electronics.
Formula:C8H7N3
InChI:InChI=1S/C8H7N3/c1-2-5-9-8(4-1)11-7-3-6-10-11/h1-7H
InChI key:InChIKey=XXTPHXNBKRVYJI-UHFFFAOYSA-N
SMILES:N1(C=CC=N1)C2=CC=CC=N2
Synonyms:- 1-(2-Pyridyl)-1H-pyrazole
- 1-(2-Pyridyl)pyrazole
- 1-(Pyridin-2-yl)-1H-pyrazole
- 2-(1H-Pyrazol-1-yl)pyridine
- 2-(Pyrazol-1-yl)pyridine
- Pyridine, 2-pyrazol-1-yl-
- Pyridine, 2-(1H-pyrazol-1-yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(1-Pyrazolyl)pyridine
CAS:Formula:C8H7N3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to lumpMolecular weight:145.172-(1H-Pyrazol-1-yl)pyridine
CAS:2-(1H-Pyrazol-1-yl)pyridineFormula:C8H7N3Purity:98%Molecular weight:145.161272-(1H-Pyrazol-1-yl)pyridine
CAS:2-(1H-Pyrazol-1-yl)pyridine is a synthetic compound that has two nitrogen atoms in its pyrazole ring. It is used as an agrochemical and bioassay to control insects, fungi, and other pests. 2-(1H-Pyrazol-1-yl)pyridine is also used as a chemical intermediate in the synthesis of chlorantraniliprole and ryanodine receptor antagonists. The chemical structure of 2-(1H-pyrazol-1-yl)pyridine consists of an imine group with a nitrogen atom on each side of the double bond. This molecule can be converted into a nitrile by reacting it with hydrochloric acid, which is why it's sometimes called "2-(hydroxymethyl)-1H pyrazole."Formula:C8H7N3Purity:Min. 95%Molecular weight:145.16 g/mol




