CymitQuimica logo

CAS 25710-18-3

:

2,3-dichloropyrido[2,3-b]pyrazine

Description:
2,3-Dichloropyrido[2,3-b]pyrazine is a heterocyclic compound characterized by its fused pyridine and pyrazine rings, which incorporate two chlorine substituents at the 2 and 3 positions of the pyridine moiety. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of chlorine atoms enhances its reactivity and can influence its solubility and stability in various solvents. 2,3-Dichloropyrido[2,3-b]pyrazine may exhibit properties such as moderate to high toxicity, necessitating careful handling and storage. Its molecular structure contributes to its unique electronic properties, making it a subject of interest in synthetic chemistry and material science. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which can be exploited in the development of new compounds. Safety data sheets and proper laboratory protocols should be consulted for handling this substance.
Formula:C7H3Cl2N3
InChI:InChI=1/C7H3Cl2N3/c8-5-6(9)12-7-4(11-5)2-1-3-10-7/h1-3H
InChI key:HWJDFFLZOOKZNL-UHFFFAOYSA-N
SMILES:c1cc2c(nc1)nc(c(Cl)n2)Cl
Synonyms:
  • 2,3-Dichloro-pyrido[2,3-b]pyrazine
  • Pyrido[2,3-B]Pyrazine, 2,3-Dichloro-
Found 4 products.