CymitQuimica logo

CAS 25711-30-2

:

1,5-dimethyl-1H-pyrazole-4-carbaldehyde

Description:
1,5-Dimethyl-1H-pyrazole-4-carbaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features two methyl groups at the 1 and 5 positions of the pyrazole ring, contributing to its unique chemical properties. The presence of a formyl group (-CHO) at the 4-position makes it an aldehyde, which is reactive and can participate in various chemical reactions, such as condensation and oxidation. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, 1,5-dimethyl-1H-pyrazole-4-carbaldehyde may exhibit specific physical properties, such as solubility in organic solvents, and its stability can be influenced by environmental factors. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H8N2O
InChI:InChI=1/C6H8N2O/c1-5-6(4-9)3-7-8(5)2/h3-4H,1-2H3
InChI key:SGNRGSSHBKKIJR-UHFFFAOYSA-N
SMILES:Cc1c(cnn1C)C=O
Synonyms:
  • 1H-Pyrazole-4-carboxaldehyde, 1,5-dimethyl-
  • Pyrazole-4-carboxaldehyde, 1,5-dimethyl-
Found 4 products.