CAS 257610-49-4
:(1-Fluorovinyl)methyldiphenylsilane
Description:
(1-Fluorovinyl)methyldiphenylsilane, with the CAS number 257610-49-4, is an organosilicon compound characterized by the presence of a fluorovinyl group and a silane moiety. This compound typically exhibits a combination of properties associated with both organic and inorganic materials. The fluorovinyl group imparts unique reactivity and stability, making it useful in various chemical applications, including polymer synthesis and surface modification. The presence of diphenyl groups enhances its hydrophobic characteristics and may contribute to its thermal stability. As a silane, it can participate in reactions that involve siloxane bond formation, making it valuable in the development of coatings, adhesives, and sealants. Additionally, the fluorine atom can influence the compound's electronic properties and reactivity, potentially enhancing its performance in specific applications. Overall, (1-Fluorovinyl)methyldiphenylsilane is a versatile compound with potential uses in materials science and chemical synthesis, although specific handling and safety considerations should be observed due to its chemical nature.
Formula:C15H15FSi
InChI:InChI=1/C15H15FSi/c1-13(16)17(2,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,1H2,2H3
SMILES:C=C(F)[Si](C)(c1ccccc1)c1ccccc1
Synonyms:- (1-Fluorovinyl)(methyl)diphenylsilane
- Benzene, 1,1'-[(1-fluoroethenyl)methylsilylene]bis-
- (1-Fluoroethenyl)(Methyl)Diphenylsilane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(1-Fluorovinyl)methyldiphenylsilane
CAS:Formula:C15H15FSiPurity:>96.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:242.37(1-Fluorovinyl)(methyl)diphenylsilane
CAS:(1-Fluorovinyl)(methyl)diphenylsilaneFormula:C15H15FSiPurity:96%Molecular weight:242.37(1-Fluorovinyl)(methyl)diphenylsilane
CAS:(1-Fluorovinyl)(methyl)diphenylsilaneFormula:C15H15FSiPurity:96%Molecular weight:242.36(1-Fluorovinyl)methyldiphenylsilane
CAS:Formula:C15H15FSiPurity:96%Color and Shape:LiquidMolecular weight:242.3635(1-Fluorovinyl)methyldiphenylsilane
CAS:Formula:C15H15FSiPurity:96.0%Color and Shape:LiquidMolecular weight:242.368(1-Fluorovinyl)methyldiphenylsilane
CAS:Controlled ProductApplications (1-Fluorovinyl)methyldiphenylsilane acts as a reagent for the preparation of fluoro C-glycosyl asparagine from C-formyl glucoside by fluorovinylation and Claisen rearrangement for the construction of α-amino acid moiety.
References Usuki, Y., et al.: ITE Lett. Batter., New Technol. Med., 7, 63 (2006)Formula:C15H15FSiColor and Shape:NeatMolecular weight:242.36(1-Fluorovinyl)methyldiphenylsilane
CAS:1-Fluorovinylmethyldiphenylsilane is a reactive, cross-coupling reagent that is used to synthesize organofluorine compounds. It reacts with nucleophiles such as sulfoxides, peroxides, halides, and amines to form an organofluorine compound. The nucleophile can be either in the presence or absence of hydrogen peroxide as a catalyst. The product of this reaction can be a sulfoxide, peroxide, or amine. 1-Fluorovinylmethyldiphenylsilane has been shown to react with nitro groups and iodides to form organofluorine compounds. 1-Fluorovinylmethyldiphenylsilane is soluble in organic solvents such as hexane and chloroform. This reagent should not be stored in metal containers because it will react with them spontaneously.Formula:C15H15FSiPurity:Min. 95%Molecular weight:242.36 g/mol






