CAS 25843-45-2
:Diazene, dimethyl-, 1-oxide
Description:
Diazene, dimethyl-, 1-oxide, also known as dimethylhydrazine oxide, is an organic compound characterized by its unique structure featuring a diazene core with two methyl groups and an oxide functional group. It is typically a colorless to pale yellow liquid with a distinctive odor. This compound is known for its reactivity, particularly in oxidation and reduction reactions, due to the presence of the diazene moiety. It is soluble in polar solvents, making it useful in various chemical applications, including as a reagent in organic synthesis. The presence of the oxide group enhances its stability compared to other diazenes, but it can still participate in reactions that involve the transfer of nitrogen or oxygen. Safety precautions are necessary when handling this compound, as it may pose health risks, including potential toxicity and irritant properties. Overall, diazene, dimethyl-, 1-oxide is a valuable compound in the field of synthetic chemistry, contributing to the development of various chemical processes and products.
Formula:C2H6N2O
InChI:InChI=1S/C2H6N2O/c1-3-4(2)5/h1-2H3
InChI key:InChIKey=DGAKHGXRMXWHBX-UHFFFAOYSA-N
SMILES:N(=NC)(C)=O
Synonyms:- Diazene, dimethyl-, 1-oxide
- NSC 171779
- Azoxymethane
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Azoxymethane
CAS:Azoxymethane (AOM) is a colon-specific carcinogen that induces DNA damage and forms DNA adducts, and is commonly used to establish mouse models of colorectal cancer.
Formula:C2H6N2OColor and Shape:SolidMolecular weight:74.08
