CymitQuimica logo

CAS 25850-22-0

:

(2,2-dimethyltetrahydro-2H-pyran-4-yl)methanamine

Description:
(2,2-Dimethyltetrahydro-2H-pyran-4-yl)methanamine, with the CAS number 25850-22-0, is an organic compound characterized by its unique structure that includes a tetrahydropyran ring substituted with two methyl groups and a methanamine functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It exhibits basic properties due to the presence of the amine group, which can participate in hydrogen bonding and act as a nucleophile in various chemical reactions. The tetrahydropyran moiety contributes to its stability and solubility in organic solvents. Additionally, this compound may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its potential reactivity and ability to serve as a building block in more complex molecular architectures. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H15NO
InChI:InChI=1/C7H15NO/c1-7(2)5-6(8)3-4-9-7/h6H,3-5,8H2,1-2H3
InChI key:VXCNRARJXVLHLI-UHFFFAOYSA-N
SMILES:CC1(C)CC(CCO1)N
Synonyms:
  • 2,2-Dimethyltetrahydro-2H-pyran-4-amine
  • 2H-Pyran-4-amine, tetrahydro-2,2-dimethyl-
Found 4 products.