CymitQuimica logo

CAS 259180-69-3

:

4-Morpholinecarboxylicacid, 2-(cyanomethyl)-, 1,1-dimethylethyl ester

Description:
4-Morpholinecarboxylic acid, 2-(cyanomethyl)-, 1,1-dimethylethyl ester, with CAS number 259180-69-3, is an organic compound characterized by its morpholine ring structure, which contributes to its potential as a versatile building block in organic synthesis. This compound features a carboxylic acid moiety, which is esterified with a tert-butyl group, enhancing its lipophilicity and stability. The presence of a cyanomethyl group introduces a nitrile functionality, which can participate in various chemical reactions, such as nucleophilic additions or cycloadditions. The morpholine ring also imparts basic properties, making it suitable for applications in pharmaceuticals and agrochemicals. Additionally, the compound's structure suggests potential for hydrogen bonding and interactions with biological targets, which may influence its reactivity and solubility in different solvents. Overall, this compound's unique combination of functional groups and structural features makes it a candidate for further research and development in synthetic chemistry and related fields.
Formula:C11H18N2O3
InChI:InChI=1S/C11H18N2O3/c1-11(2,3)16-10(14)13-6-7-15-9(8-13)4-5-12/h9H,4,6-8H2,1-3H3
InChI key:WHRDWLLTRDAEFB-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCOC(C1)CC#N
Synonyms:
  • 2-Cyanomethyl-Morpholine-4-Carboxylic Acid Tert-Butyl Ester
Found 2 products.