CAS 25981-82-2: 2,3,3,5-Tetramethyl-3H-indole
Description:2,3,3,5-Tetramethyl-3H-indole is an organic compound belonging to the indole family, characterized by its bicyclic structure that includes a fused benzene and pyrrole ring. This compound features four methyl groups attached to the indole structure, specifically at the 2, 3, and 5 positions, which significantly influence its physical and chemical properties. It is typically a solid at room temperature and exhibits a relatively low solubility in water due to its hydrophobic nature, while being more soluble in organic solvents. The presence of multiple methyl groups enhances its steric bulk and can affect its reactivity and interaction with other molecules. 2,3,3,5-Tetramethyl-3H-indole may exhibit interesting biological activities, making it of interest in various fields, including pharmaceuticals and materials science. Its unique structure and properties can also lead to applications in organic synthesis and as a potential building block for more complex chemical entities. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C12H15N
InChI:InChI=1S/C12H15N/c1-8-5-6-11-10(7-8)12(3,4)9(2)13-11/h5-7H,1-4H3
InChI key:InChIKey=RQVAPBRSUHSDGP-UHFFFAOYSA-N
SMILES:N=1C=2C=CC(=CC2C(C1C)(C)C)C
- Synonyms:
- 2,3,3,5-Tetramethyl-3H-indole
- 2,3,3,5-Tetramethylindole
- 3H-Indole, 2,3,3,5-tetramethyl-
- 2,3,3,5-Tetramethylindolenine