CymitQuimica logo

CAS 25984-63-8

:

4-Hydroxythiobenzamide

Description:
4-Hydroxythiobenzamide is an organic compound characterized by the presence of a thiol group and a hydroxyl group attached to a benzamide structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, and sulfur atoms, reflecting its functional groups. The compound is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to act as a nucleophile and participate in various chemical reactions. It is generally a solid at room temperature and may exhibit moderate solubility in polar solvents. The presence of the hydroxyl group contributes to its reactivity and potential for hydrogen bonding, while the thiol group can impart unique properties, such as antioxidant activity. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 4-Hydroxythiobenzamide serves as an interesting subject for further research in synthetic chemistry and medicinal applications.
Formula:C7H7NOS
InChI:InChI=1/C7H7NOS/c8-7(10)5-1-3-6(9)4-2-5/h1-4,9H,(H2,8,10)
InChI key:VDTNKXSVUGXUOJ-UHFFFAOYSA-N
SMILES:c1cc(ccc1C(=S)N)O
Synonyms:
  • 4-Hydroxybenzene-1-carbothioamide
  • 4-Hydroxybenzothioamide
  • 4-Hydroxy Thiobenzamide
  • 4-[Amino(Sulfanyl)Methylidene]Cyclohexa-2,5-Dien-1-One
  • 4-Hydroxybenzenecarbothioamide
  • 4-Hydroxy Benzothioamide
Found 10 products.