CymitQuimica logo

CAS 260-50-4

:

Benzo[g]quinoxaline

Description:
Benzo[g]quinoxaline is a polycyclic aromatic compound characterized by its fused benzene and quinoxaline rings. It is a heterocyclic compound, meaning it contains nitrogen atoms in its ring structure, which contributes to its unique chemical properties. The molecular formula of benzo[g]quinoxaline typically includes carbon and nitrogen, reflecting its aromatic nature. This compound is known for its potential applications in organic electronics, particularly in the development of organic semiconductors and light-emitting devices due to its electronic properties. Additionally, benzo[g]quinoxaline exhibits fluorescence, making it useful in various photonic applications. Its structure allows for interactions with biological systems, leading to investigations into its potential as a pharmaceutical agent. However, like many polycyclic aromatic compounds, it may also pose environmental and health risks, necessitating careful handling and assessment of its toxicity. Overall, benzo[g]quinoxaline is a compound of interest in both materials science and medicinal chemistry, with ongoing research into its properties and applications.
Formula:C12H8N2
InChI:InChI=1S/C12H8N2/c1-2-4-10-8-12-11(7-9(10)3-1)13-5-6-14-12/h1-8H
InChI key:XEMRLVBSKVCUDL-UHFFFAOYSA-N
SMILES:C1=CC=C2C=C3C(=CC2=C1)N=CC=N3
Found 5 products.