CymitQuimica logo

CAS 260441-44-9

:

5-chloro-2-(piperidin-4-yloxy)pyridine

Description:
5-Chloro-2-(piperidin-4-yloxy)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 5-position with a chlorine atom and at the 2-position with a piperidin-4-yloxy group. This structure contributes to its potential biological activity, particularly in medicinal chemistry, where such compounds may exhibit pharmacological properties. The presence of the piperidine moiety can enhance lipophilicity and influence the compound's interaction with biological targets, such as receptors or enzymes. The chlorine atom may also play a role in modulating the compound's reactivity and stability. Typically, compounds like this are evaluated for their efficacy in various therapeutic areas, including neuropharmacology and anti-inflammatory applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it important for researchers to consider these characteristics during synthesis and application. Safety and handling precautions are essential, as with any chemical substance, particularly those with potential biological activity.
Formula:C10H13ClN2O
InChI:InChI=1/C10H13ClN2O/c11-8-1-2-10(13-7-8)14-9-3-5-12-6-4-9/h1-2,7,9,12H,3-6H2
InChI key:AMZYBOJPLHNYJD-UHFFFAOYSA-N
SMILES:c1cc(ncc1Cl)OC1CCNCC1
Synonyms:
  • Pyridine, 5-Chloro-2-(4-Piperidinyloxy)-
  • 5-Chloro-2-(piperidin-4-yloxy)pyridine
Found 2 products.