CAS 26106-63-8
:Tetrahydrofuran-2,3,4,5-tetracarboxylic acid
Description:
Tetrahydrofuran-2,3,4,5-tetracarboxylic acid, with the CAS number 26106-63-8, is a cyclic dicarboxylic acid derivative characterized by its four carboxylic acid functional groups attached to a tetrahydrofuran ring. This compound is typically a white crystalline solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of multiple carboxylic acid groups, which can engage in hydrogen bonding. The presence of these functional groups imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Tetrahydrofuran-2,3,4,5-tetracarboxylic acid is of interest in organic synthesis and materials science, particularly in the development of biodegradable polymers and as a potential building block for more complex molecules. Its reactivity and functional versatility make it a valuable compound in both academic research and industrial applications. However, safety precautions should be observed when handling this substance, as with many organic acids, due to its corrosive nature.
Formula:C8H8O9
InChI:InChI=1S/C8H8O9/c9-5(10)1-2(6(11)12)4(8(15)16)17-3(1)7(13)14/h1-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16)
InChI key:InChIKey=UFOIOXZLTXNHQH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(C(O)=O)C(C(O)=O)OC1C(O)=O
Synonyms:- (2R,3R,4S,5S)-tetrahydrofuran-2,3,4,5-tetracarboxylate (non-preferred name)
- (2R,3S,4S,5S)-tetrahydrofuran-2,3,4,5-tetracarboxylate (non-preferred name)
- 2,3,4,5-Furantetracarboxylic acid, tetrahydro-
- 2,3,4,5-Tetracarboxytetrahydrofuran
- 2,5-Anhydro-3,4-Dicarboxy-3,4-Dideoxyhexaric Acid
- 2,5-anhydro-3,4-dicarboxy-3,4-dideoxy-D-allaric acid
- Furantetracarboxylic acid, tetrahydro-
- NSC 122277
- Tetrahydro-2,3,4,5-furantetracarboxylic acid
- Tetrahydrofuran-2r,3t,4t,5c-tetracarboxylic acid
- Tetrahydrofurantetracarboxylic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Tetrahydrofuran-2,3,4,5-tetracarboxylic Acid
CAS:Formula:C8H8O9Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:248.14Tetrahydrofuran-2,3,4,5-Tetracarboxylic Acid
CAS:Tetrahydrofuran-2,3,4,5-Tetracarboxylic AcidFormula:C8H8O9Purity:98%Color and Shape:SolidMolecular weight:248.1432,3,4,5-Furantetracarboxylic acid, tetrahydro-
CAS:Formula:C8H8O9Purity:98%Color and Shape:SolidMolecular weight:248.1437Tetrahydrofuran-2,3,4,5-tetracarboxylic acid
CAS:Tetrahydrofuran-2,3,4,5-tetracarboxylic acid (THF-TTCA) is a polycarboxylic acid that can be extracted from coal tar. It has a number of uses as an extractant in the production of polycarbonates and other plastics. Tetrahydrofuran-2,3,4,5-tetracarboxylic acid has been shown to crystallize from solution at high temperatures and pressures. The crystal structure of THF-TTCA consists of a ring of six carboxylate groups with three molecules of water coordinating to form hydrogen bonds. Tetrahydrofuran-2,3,4,5-tetracarboxylic acid has the structural analog of the metal ion tetraammineborane (NHBH). This compound is acidic and binds strongly to metal ions such as copper(II) or cobalt(IIIFormula:C8H8O9Purity:Min. 95%Molecular weight:248.14 g/molTetrahydrofuran-2,3,4,5-tetracarboxylic acid
CAS:Formula:C8H8O9Purity:98%+;RGColor and Shape:SolidMolecular weight:248.143





