CAS 2611-67-8
:Cyanidin 3,5-diglucoside
Description:
Cyanidin 3,5-diglucoside is a naturally occurring anthocyanin, a type of flavonoid pigment responsible for the red, purple, and blue colors in many fruits and vegetables. It is characterized by its chemical structure, which includes a cyanidin aglycone linked to two glucose molecules at the 3 and 5 positions. This compound is known for its antioxidant properties, contributing to various health benefits, including anti-inflammatory and potential anti-cancer effects. Cyanidin 3,5-diglucoside is soluble in water and exhibits stability under acidic conditions, making it prevalent in acidic fruits like cherries and berries. Its presence in the diet is associated with various health benefits, including improved cardiovascular health and enhanced cognitive function. Additionally, it is used in food coloring and as a natural dye due to its vibrant color. The compound's stability and bioavailability can be influenced by factors such as pH and the presence of other compounds, which can affect its absorption and efficacy in biological systems.
Formula:C27H31O16·Cl
InChI:InChI=1S/C27H30O16.ClH/c28-7-17-19(33)21(35)23(37)26(42-17)40-15-5-10(30)4-14-11(15)6-16(25(39-14)9-1-2-12(31)13(32)3-9)41-27-24(38)22(36)20(34)18(8-29)43-27;/h1-6,17-24,26-29,33-38H,7-8H2,(H2-,30,31,32);1H/t17-,18-,19-,20-,21+,22+,23-,24-,26-,27-;/m1./s1
InChI key:InChIKey=QDVZZZBBPRFPDG-DHJOXOLYSA-N
SMILES:O(C=1C2=C([O+]=C(C(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)=C2)C4=CC(O)=C(O)C=C4)C=C(O)C1)[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O.[Cl-]
Synonyms:- 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-3,5-bis(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-7-hydroxy-, chloride
- 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-3,5-bis(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-7-hydroxy-, chloride (1:1)
- 2-(3,4-Dihydroxyphenyl)-3,5-bis(beta-D-glucopyranosyloxy)-7-hydroxy-1-benzopyrylium chloride
- 2-(3,4-dihydroxyphenyl)-3-(beta-D-glucopyranosyloxy)-7-hydroxychromenium-5-yl beta-D-glucopyranoside
- 2-(3,4-dihydroxyphenyl)-3-(beta-D-glucopyranosyloxy)-7-hydroxychromenium-5-yl beta-D-glucopyranoside chloride
- 2-(3,4-dihydroxyphenyl)-3-(hexopyranosyloxy)-7-hydroxy-2H-chromen-5-yl hexopyranoside
- 3,5-Bis(glucosyloxy)-3′,4′,7-trihydroxyflavylium chloride
- Cyanidin 3,5-diglucoside
- Cyanidol 3,5-diglucoside chloride
- Cyanin
- Cyanin chloride
- Nsc 81163
- 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-3,5-bis(β-D-glucopyranosyloxy)-7-hydroxy-, chloride (1:1)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Cyanin chloride
CAS:Cyanin chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C27H31O16ClPurity:(HPLC) ≥97%Color and Shape:PowderMolecular weight:646.953,5-Bis(glucosyloxy)-3',4',7-trihydroxyflavylium chloride
CAS:Formula:C27H31ClO16Purity:90%Color and Shape:SolidMolecular weight:646.97842-(3,4-Dihydroxyphenyl)-7-hydroxy-3,5-bis(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)chromenylium chloride
CAS:2-(3,4-Dihydroxyphenyl)-7-hydroxy-3,5-bis(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)chromenylium chlorideFormula:C27H31ClO16Purity:99%Molecular weight:646.98Cyanin chloride
CAS:Formula:C27H31ClO16Purity:≥ 95.0% (Anhydrous basis)Color and Shape:PowderMolecular weight:646.98Cyanidin-3,5-O-diglucoside chloride (Standard)
CAS:Cyanidin-3,5-O-diglucoside chloride (Standard) is a reference standard for research and analysis in studies involving Cyanidin-3,5-O-diglucoside chloride. Cyanidin-3,5-O-diglucoside chloride has antioxidant activity. Cyanidin-3,5-O-diglucoside inhibits hyperbaric pressure-induced GLAST decrease and can be used in glaucoma studies. Cyanidin-3,5-O-diglucoside chloride is easily degraded by hydrolysis and /orFormula:C27H31ClO16Color and Shape:SolidMolecular weight:646.98Cyanidin 3,5-diglucoside chloride
CAS:Natural glycosideFormula:C27H31O16ClPurity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:646.99Cyanidin-3,5-di-O-glucoside
CAS:Cyanidin-3,5-di-O-glucoside is a natural anthocyanin pigment, which is derived from various fruits, flowers, and berries. It is primarily sourced from plants such as blackcurrants, bilberries, and elderberries, where it is responsible for their distinctive red, purple, and blue pigmentation. The molecule acts as a potent antioxidant by donating hydrogen atoms or electrons to free radicals, thus neutralizing them and preventing oxidative stress. This mechanism is crucial in protecting biological molecules like DNA, proteins, and lipids from oxidative damage.Formula:C27H31O16·ClPurity:(Hplc-Ms) Min. 80 Area-%Color and Shape:Brown PowderMolecular weight:646.99 g/molCyanidin-3,5-O-diglucoside chloride
CAS:Antioxidant, Cyanidin-3,5-diglucoside chloride aids in glaucoma research, counters GLAST decline, degrades via hydrolysis.Formula:C27H31ClO16Purity:98%Color and Shape:Light Green PowderMolecular weight:646.98








