CAS 26113-44-0
:3-methoxybenzenecarboximidamide hydrochloride (1:1)
Description:
3-Methoxybenzenecarboximidamide hydrochloride, with the CAS number 26113-44-0, is a chemical compound characterized by its structural features, which include a methoxy group and a carboximidamide functional group attached to a benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydrochloride indicates that it is a salt form, which often enhances its stability and solubility. In terms of its chemical behavior, 3-methoxybenzenecarboximidamide hydrochloride may exhibit properties typical of amides and aromatic compounds, including potential hydrogen bonding and reactivity in nucleophilic substitution reactions. It may be utilized in pharmaceutical research and development due to its potential biological activity, although specific applications would depend on further studies. As with any chemical substance, proper handling and safety precautions should be observed, given its potential effects on health and the environment.
Formula:C8H11ClN2O
InChI:InChI=1/C8H10N2O.ClH/c1-11-7-4-2-3-6(5-7)8(9)10;/h2-5H,1H3,(H3,9,10);1H
SMILES:COc1cccc(c1)C(=N)N.Cl
Synonyms:- Benzenecarboximidamide, 3-Methoxy-, Hydrochloride (1:1)
- 3-Methoxybenzamidine hydrochloride
- 3-Methoxybenzamidine HCl
- 3-Methoxybenzenecarboximidamide hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Methoxybenzamidine, HCl
CAS:Formula:C8H11ClN2OPurity:95%Color and Shape:SolidMolecular weight:186.63873-Methoxybenzene-1-carboximidamide hydrochloride
CAS:3-Methoxybenzene-1-carboximidamide hydrochlorideFormula:C8H11ClN2OPurity:98%Molecular weight:186.643-Methoxybenzamidine hydrochloride
CAS:3-Methoxybenzamidine hydrochlorideFormula:C8H11ClN2OPurity:95%Molecular weight:186.643-Methoxybenzamidine hydrochloride
CAS:3-Methoxybenzamidine hydrochloride is a chemical that belongs to the group of acid chlorides. It is used in organic synthesis as an intermediate for the production of triazines, which are used as herbicides and insecticides. 3-Methoxybenzamidine hydrochloride is usually prepared by reacting methylamine with nitrous acid. The use of 3-methoxybenzamidine hydrochloride in organic synthesis has been shown to be highly efficient, with yields up to 95%. This chemical also exhibits fluorescence at low temperatures.Formula:C8H10N2O·HClPurity:Min. 95%Color and Shape:PowderMolecular weight:186.64 g/mol3-Methoxybenzamidine hydrochloride
CAS:Formula:C8H11ClN2OPurity:95%Color and Shape:SolidMolecular weight:186.64




