CAS 261623-50-1
:4-(2-Methoxyphenyl)-1-piperazineacetamidoxime
Description:
4-(2-Methoxyphenyl)-1-piperazineacetamidoxime, identified by its CAS number 261623-50-1, is a chemical compound that features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound is characterized by the presence of a methoxyphenyl group, which contributes to its aromatic properties and may influence its biological activity. The acetamidoxime functional group indicates that it contains both an amide and an oxime, suggesting potential reactivity and interactions in biological systems. The presence of these functional groups may enhance its solubility and stability in various solvents. Additionally, compounds like this one are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The specific arrangement of atoms and functional groups in 4-(2-Methoxyphenyl)-1-piperazineacetamidoxime may confer unique characteristics that could be relevant in drug design and development, particularly in targeting specific biological pathways or receptors.
Formula:C13H20N4O2
InChI:InChI=1/C13H20N4O2/c1-19-12-5-3-2-4-11(12)17-8-6-16(7-9-17)10-13(14)15-18/h2-5,18H,6-10H2,1H3,(H2,14,15)
Synonyms:- 1-piperazineethanimidamide, N'-hydroxy-4-(2-methoxyphenyl)-
- N-hydroxy-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethanimidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N'-hydroxy-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethanimidamide
CAS:Formula:C13H20N4O2Molecular weight:264.3235
