CAS 261733-18-0
:4,6-Bis(diphenylphosphino)phenoxazine
Description:
4,6-Bis(diphenylphosphino)phenoxazine is a chemical compound characterized by its unique structure, which includes a phenoxazine core substituted with two diphenylphosphino groups at the 4 and 6 positions. This compound is notable for its potential applications in coordination chemistry and catalysis, particularly in the formation of metal complexes. The presence of the diphenylphosphino groups enhances its ability to act as a bidentate ligand, facilitating interactions with transition metals. The phenoxazine moiety contributes to the compound's electronic properties, making it suitable for applications in organic electronics and photochemistry. Additionally, the compound may exhibit interesting photophysical properties, such as fluorescence or phosphorescence, depending on its environment and the presence of metal ions. Its stability and reactivity can vary based on the specific conditions, including solvent and temperature. Overall, 4,6-Bis(diphenylphosphino)phenoxazine represents a versatile building block in the development of advanced materials and catalysts in modern chemistry.
Formula:C36H27NOP2
InChI:InChI=1/C36H27NOP2/c1-5-15-27(16-6-1)39(28-17-7-2-8-18-28)33-25-13-23-31-35(33)38-36-32(37-31)24-14-26-34(36)40(29-19-9-3-10-20-29)30-21-11-4-12-22-30/h1-26,37H
SMILES:c1ccc(cc1)P(c1ccccc1)c1cccc2c1Oc1c(cccc1P(c1ccccc1)c1ccccc1)N2
Synonyms:- 10H-phenoxazine, 4,6-bis(diphenylphosphino)-
- 4,6-Bis(diphenylphosphino)-10H-phenoxazine
- 4,6-bis(diphenylphosphanyl)-10H-phenoxazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4,6-Bis(diphenylphosphino)phenoxazine
CAS:Formula:C36H27NOP2Purity:>98.0%(HPLC)(N)Color and Shape:White to Light gray to Green powder to crystalMolecular weight:551.574,6-Bis(diphenylphosphino)phenoxazine, min. 98% NIXANTPHOS
CAS:4,6-Bis(diphenylphosphino)phenoxazine, min. 98% NIXANTPHOS
Formula:C36H27NOP2Purity:min. 98%Color and Shape:white to off-white pwdr.Molecular weight:551.5510H-Phenoxazine, 4,6-bis(diphenylphosphino)-
CAS:Formula:C36H27NOP2Purity:98%Color and Shape:SolidMolecular weight:551.55324,6-Bis(diphenylphosphino)-10H-phenoxazine
CAS:4,6-Bis(diphenylphosphino)-10H-phenoxazineFormula:C36H27NOP2Purity:98%Color and Shape:SolidMolecular weight:551.55NixantPhos
CAS:4,6-Bis(diphenylphosphino)-10H-phenoxazineFormula:C36H27NOP2Purity:97%Molecular weight:551.554,6-Bis(diphenylphosphino)phenoxazine
CAS:The optimal reaction conditions for the cross-coupling of aryl halides with diphosphines are known. The reaction is catalyzed by palladium and is an efficient method for the synthesis of alkenes and alkynes. In this process, a nucleophilic attack on the carbon atom in the phosphine occurs, which generates a reactive intermediate that can undergo hydrogen bonding interactions with the aryl halide. This reaction is also called "Pd-catalyzed cross-coupling." The reaction proceeds through two steps: (1) oxidative carbonylation of the phenoxazine to form an enolate intermediate and (2) reductive elimination of chlorine from the chloroformate. The synergic effect between two molecules is seen when one molecule has a structural property that enhances or diminishes another molecule's properties. For example, if one molecule has a high electron density, then it may be able to stabilize negative charge on another molecule's atoms; ifFormula:C36H27NOP2Purity:Min. 95%Molecular weight:551.55 g/mol






