CymitQuimica logo

CAS 261946-00-3

:

5-(4-tert-butylphenyl)-4-(furan-2-ylmethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:
5-(4-tert-butylphenyl)-4-(furan-2-ylmethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique structural features, including a triazole ring, a furan moiety, and a tert-butylphenyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the thione functional group suggests it may participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Its molecular structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the tert-butyl group enhances lipophilicity, which can influence its bioavailability and interaction with biological targets. The compound's stability, reactivity, and potential applications in fields such as pharmaceuticals or agrochemicals would depend on its specific interactions and the presence of functional groups. Overall, this compound represents a class of triazole derivatives that may have significant implications in various chemical and biological contexts.
Formula:C17H19N3OS
InChI:InChI=1/C17H19N3OS/c1-17(2,3)13-8-6-12(7-9-13)15-18-19-16(22)20(15)11-14-5-4-10-21-14/h4-10H,11H2,1-3H3,(H,19,22)
InChI key:XOPAJNHNHTXVRT-UHFFFAOYSA-N
SMILES:CC(C)(C)c1ccc(cc1)c1nnc(n1Cc1ccco1)S
Synonyms:
  • 4H-1,2,4-triazole-3-thiol, 5-[4-(1,1-dimethylethyl)phenyl]-4-(2-furanylmethyl)-
  • 5-(4-tert-Butylphenyl)-4-(2-furylmethyl)-4H-1,2,4-triazole-3-thiol
  • 5-[4-(Tert-Butyl)Phenyl]-4-(2-Furylmethyl)-4H-1,2,4-Triazole-3-Thiol
Found 3 products.