CAS 261969-04-4
:L-Phenylalanine,L-valyl-L-lysyl-L-phenylalanylglycyl-L-valylglycyl-L-phenylalanyl-L-lysyl-L-valyl-L-methionyl-L-valyl-(9CI)
Description:
L-Phenylalanine, L-valyl-L-lysyl-L-phenylalanylglycyl-L-valylglycyl-L-phenylalanyl-L-lysyl-L-valyl-L-methionyl-L-valyl-(9CI) is a complex peptide composed of multiple amino acids, including phenylalanine, valine, lysine, glycine, and methionine. This substance is characterized by its specific sequence of amino acids, which contributes to its unique properties and potential biological activities. Peptides like this one can exhibit various functions, including roles in signaling, enzyme activity, and structural support in biological systems. The presence of aromatic amino acids, such as phenylalanine and valine, may influence the peptide's hydrophobicity and interaction with other biomolecules. Additionally, the peptide's structure can affect its stability, solubility, and potential applications in pharmaceuticals or biotechnology. As a synthetic compound, it may be used in research settings to study protein interactions or as a model for understanding peptide behavior in biological contexts. However, specific characteristics such as solubility, melting point, and biological activity would require empirical data for precise evaluation.
Formula:C68H104N14O13S
InChI:InChI=1S/C68H104N14O13S/c1-40(2)55(71)64(90)76-47(29-19-21-32-69)60(86)78-50(35-44-23-13-10-14-24-44)59(85)72-39-54(84)80-56(41(3)4)65(91)73-38-53(83)74-51(36-45-25-15-11-16-26-45)63(89)75-48(30-20-22-33-70)61(87)81-57(42(5)6)66(92)77-49(31-34-96-9)62(88)82-58(43(7)8)67(93)79-52(68(94)95)37-46-27-17-12-18-28-46/h10-18,23-28,40-43,47-52,55-58H,19-22,29-39,69-71H2,1-9H3,(H,72,85)(H,73,91)(H,74,83)(H,75,89)(H,76,90)(H,77,92)(H,78,86)(H,79,93)(H,80,84)(H,81,87)(H,82,88)(H,94,95)/t47-,48-,49-,50-,51-,52-,55-,56-,57-,58-/m0/s1
InChI key:ODWOEJYNFFTQOH-IVGXUUFVSA-N
SMILES:CC(C)[C@@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)NCC(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](CC2=CC=CC=C2)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)O)N
Synonyms:- Calp2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
CALP2 acetate(261969-04-4 free base)
CAS:CALP2 acetate(261969-04-4 free base)Formula:C68H104N14O13SPurity:≥95%Molecular weight:1357.7CALP2
CAS:CALP2 is a CaM antagonist blocking EF-hand/Ca2+ site; inhibits CaM phosphodiesterase, raises Ca2+, and activates alveolar macrophages.Formula:C68H104N14O13SPurity:98%Color and Shape:SolidMolecular weight:1357.72CALP2
CAS:Calp2 is a protein that regulates the intracellular calcium concentration. Calp2 is found in the ventral horn of the spinal cord, where it is involved in nerve injury and inflammatory cell activation. Calp2 has been shown to be upregulated during eye disorders, such as uveitis and retinitis, with calp2 knockout mice showing reduced inflammation. Calp2 also interacts with target enzymes such as TNF-α, which are responsible for inflammation. The protein can be conjugated to drugs or other molecules to target specific cells or tissues.
Formula:C68H104N14O13SPurity:Min. 95%Molecular weight:1,357.7 g/mol




