CAS 26198-21-0
:1-hydroxy-6-(trifluoromethyl)benzo-triazole
Description:
1-Hydroxy-6-(trifluoromethyl)benzo-triazole, identified by its CAS number 26198-21-0, is a chemical compound that features a triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound is characterized by the presence of a hydroxyl group (-OH) and a trifluoromethyl group (-CF3) attached to a benzene ring, which significantly influences its chemical properties and reactivity. The trifluoromethyl group is known for imparting lipophilicity and enhancing the compound's stability, while the hydroxyl group can participate in hydrogen bonding, affecting solubility and interaction with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its unique structure allows for potential applications in various fields, including materials science and organic synthesis. As with many triazole derivatives, it may also possess fungicidal or herbicidal properties, although specific biological activities would require further investigation.
Formula:C7H4F3N3O
InChI:InChI=1/C7H4F3N3O/c8-7(9,10)4-1-2-5-6(3-4)13(14)12-11-5/h1-3,14H
SMILES:c1cc2c(cc1C(F)(F)F)n(nn2)O
Synonyms:- 1-Hydroxy-6-trifluoromethylbenzotriazole
- 6-(trifluoromethyl)-1H-benzotriazol-1-ol
- 1-Hydroxy-6-(Trifluoromethyl)Benzotriazole
- 1-Hydroxy-6-(trifluoromethyl)-1H-benzotriazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Hydroxy-6-(trifluoromethyl)benzotriazole
CAS:Formula:C7H4F3N3OPurity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:203.121-Hydroxy-6-(trifluoromethyl)-1H-benzotriazole
CAS:1-Hydroxy-6-(trifluoromethyl)-1H-benzotriazoleFormula:C7H4F3N3OPurity:98%Color and Shape:SolidMolecular weight:203.121361H-Benzotriazole, 1-hydroxy-6-(trifluoromethyl)-
CAS:Formula:C7H4F3N3OPurity:98%Color and Shape:SolidMolecular weight:203.1214Ref: IN-DA002S8D
250gTo inquire500gTo inquire1g28.00€5g55.00€10g83.00€25g134.00€50g184.00€100g328.00€1-Hydroxy-6-(trifluoromethyl)benzotriazole
CAS:Formula:C7H4F3N3OPurity:98%Color and Shape:White to almost white powderMolecular weight:203.1241-Hydroxy-6-(Trifluoromethyl)Benzotriazole
CAS:1-Hydroxy-6-(trifluoromethyl)benzotriazole is a chemical compound that is used as a reagent and an additive in organic synthesis. It has been shown to react with the 7-aminocephalosporanic acid to form a reactive molecule, which is then acylated with various amines. The reaction time can be modified by adding certain additives, such as chloride or uridine. 1-Hydroxy-6-(trifluoromethyl)benzotriazole is also a solid phase synthesis, which means it reacts with other molecules during the synthesis process to form new substances. It also has acidic properties, and can act as a nucleophile in the presence of aminocephalosporanic acid. The structural formula for this chemical is shown below:Formula:C7H4F3N3OPurity:Min. 95%Molecular weight:203.12 g/mol




