CAS 26278-79-5
:2-Amino-6-benzothiazolol
Description:
2-Amino-6-benzothiazolol, with the CAS number 26278-79-5, is an organic compound characterized by the presence of both an amino group and a benzothiazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential solubility in polar solvents due to the amino group. The benzothiazole structure contributes to its aromatic character, which can influence its reactivity and stability. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds with antimicrobial or anticancer properties. The presence of the amino group can also facilitate hydrogen bonding, affecting its interactions in biological systems. Additionally, 2-amino-6-benzothiazolol may undergo various chemical reactions, such as electrophilic substitution or nucleophilic attack, due to the functional groups present. Overall, its unique structure and functional groups make it a compound of interest in both synthetic and medicinal chemistry.
Formula:C7H6N2OS
InChI:InChI=1S/C7H6N2OS/c8-7-9-5-2-1-4(10)3-6(5)11-7/h1-3,10H,(H2,8,9)
InChI key:InChIKey=VLNVTNUTGNBNBY-UHFFFAOYSA-N
SMILES:NC1=NC=2C(S1)=CC(O)=CC2
Synonyms:- 2-Amino-1,3-benzothiazol-6-ol
- 2-Amino-6-benzothiazolol
- 6-Benzothiazolol, 2-amino-
- 6-Hydroxy-2-aminobenzothiazole
- 6-Hydroxybenzothiazol-2-amine
- 2-Amino-6-hydroxybenzothiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Amino-benzothiazol-6-ol
CAS:Formula:C7H6N2OSPurity:98%Color and Shape:Solid, Crystalline PowderMolecular weight:166.22-Amino-6-hydroxy-1,3-benzothiazole
CAS:2-Amino-6-hydroxy-1,3-benzothiazoleFormula:C7H6N2OSPurity:≥95%Color and Shape:Solid-PowderMolecular weight:166.200336-Benzothiazolol, 2-amino-
CAS:Formula:C7H6N2OSPurity:97%Color and Shape:SolidMolecular weight:166.20032-aminobenzo[d]thiazol-6-ol
CAS:2-aminobenzo[d]thiazol-6-olFormula:C7H6N2OSPurity:≥98%Molecular weight:166.22-aminobenzo[d]thiazol-6-ol
CAS:2-aminobenzo[d]thiazol-6-ol: antimicrobial, antioxidant, anticancer; may trigger cancer cell apoptosis.Formula:C7H6N2OSPurity:98.92%Color and Shape:SolidMolecular weight:166.22-Amino-6-hydroxybenzothiazole
CAS:2-Amino-6-hydroxybenzothiazole is a chemical compound that has been shown to have chemiluminescence properties. It is produced in vivo by the synthetase enzyme from the amino acid L-phenylalanine and hydroxybenzothiazole. The compound is expressed in basophilic leukemia cells, which are cells that stain with basic dyes. 2-Amino-6-hydroxybenzothiazole can be used as a marker of these cells in vitro. A second order rate constant of 1.5 × 10 M−1 s−1 was determined for this reaction, which is consistent with other reactions of this type. 2-Amino-6-hydroxybenzothiazole has also been shown to be effective at treating cancer and inflammatory bowel disease by enhancing growth factor production and inhibiting cell proliferation.
Formula:C7H6N2OSPurity:Min. 95%Color and Shape:White To Grey SolidMolecular weight:166.2 g/mol




