CAS 2631-77-8
:3,5-Diiodosalicylaldehyde
Description:
3,5-Diiodosalicylaldehyde is an organic compound characterized by the presence of two iodine atoms and an aldehyde functional group attached to a salicylic acid derivative. Its molecular structure features a benzene ring with hydroxyl (-OH) and aldehyde (-CHO) substituents, along with the two iodine atoms located at the 3 and 5 positions relative to the aldehyde group. This compound is typically a solid at room temperature and may exhibit a pale yellow to brown color. It is known for its reactivity, particularly in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the iodine substituents. Additionally, 3,5-Diiodosalicylaldehyde can participate in various chemical reactions, including condensation and complexation, making it useful in organic synthesis and as a potential precursor for other chemical compounds. Its iodine content also suggests potential applications in medicinal chemistry and materials science, particularly in the development of iodine-containing pharmaceuticals or functional materials. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.
Formula:C7H4I2O2
InChI:InChI=1S/C7H4I2O2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H
InChI key:InChIKey=MYWSBJKVOUZCIA-UHFFFAOYSA-N
SMILES:C(=O)C1=C(O)C(I)=CC(I)=C1
Synonyms:- 2-Hydroxy-3,5-Diiodobenzaldehyde
- 3,5-Diiodo-2-hydroxybenzaldehyde
- 3,5-Diiodo-2-hydroxybenzaldehyde~2-Hydroxy-3,5-diiodobenzaldehyde
- 3,5-Iodosalicylaldehyde
- Benzaldehyde, 2-hydroxy-3,5-diiodo-
- Salicylaldehyde, 3,5-diiodo-
- 3,5-Diiodosalicylaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,5-Diiodosalicylaldehyde
CAS:Formula:C7H4I2O2Purity:>98.0%(GC)(T)Color and Shape:White to Yellow to Green powder to crystalMolecular weight:373.923,5-Diiodosalicylaldehyde, 98+%
CAS:3,5-Diiodosalicylaldehyde is used to synthesize new Schiff bases, (2,4-diiodo-6-[(2-morpholin-4-yl-ethylimino)-methyl]-phenol and 2,4-diiodo-6-[(3-morpholin-4-yl-propylimino)-methyl]-phenol) and the new tridentate ligand, [(2-hydroxy-3,5-diiodo-benzylidene)-amino]-acetic acid (HDBA), 3-bromo-N?-(2-hFormula:C7H4I2O2Purity:98+%Color and Shape:Powder, Cream or pale yellow to yellow-green or yellow-brownMolecular weight:373.92Benzaldehyde, 2-hydroxy-3,5-diiodo-
CAS:Formula:C7H4I2O2Purity:98%Color and Shape:SolidMolecular weight:373.91443,5-Diiodo-2-hydroxybenzaldehyde
CAS:3,5-Diiodo-2-hydroxybenzaldehydeFormula:C7H4I2O2Purity:98%Color and Shape:Pale yellow Solid-PowderMolecular weight:373.91443,5-Diiodosalicylaldehyde
CAS:3,5-Diiodosalicylaldehyde is a chemical compound found in the mushroom E. cloacae. It has been used as a model system to study the enzymatic reaction of methylene transfer from active methylene to inactive methylene. FTIR spectroscopy was used to confirm this reaction and structural analysis revealed that 3,5-diiodosalicylaldehyde is an active methylene with a structure similar to coumarin derivatives. The crystal structure of 3,5-diiodosalicylaldehyde was determined by X-ray crystallography and it was found that the molecule adopts a monoclinic coordination geometry.Formula:C7H4I2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:373.91 g/mol2-Hydroxy-3,5-diiodobenzaldehyde
CAS:Formula:C7H4I2O2Purity:95%Color and Shape:SolidMolecular weight:373.916





