CymitQuimica logo

CAS 263396-44-7

:

D-4-Cyanophenylalanine

Description:
D-4-Cyanophenylalanine, identified by its CAS number 263396-44-7, is an amino acid derivative characterized by the presence of a cyanophenyl group attached to the phenylalanine backbone. This compound features a cyano group (-CN) at the para position of the phenyl ring, which can influence its chemical reactivity and interactions. D-4-Cyanophenylalanine is typically utilized in biochemical research, particularly in studies involving protein synthesis and structure, as it can serve as a non-canonical amino acid. Its incorporation into peptides or proteins can provide insights into protein folding, stability, and function. The presence of the cyano group may also impart unique spectroscopic properties, making it useful in analytical applications. As with many amino acids, it is expected to exhibit typical properties such as solubility in polar solvents and the ability to participate in hydrogen bonding. However, specific handling and safety measures should be observed due to the potential toxicity associated with cyanide derivatives.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c11-6-8-3-1-7(2-4-8)5-9(12)10(13)14/h1-4,9H,5,12H2,(H,13,14)/t9-/m1/s1
InChI key:KWIPUXXIFQQMKN-SECBINFHSA-N
SMILES:C1=CC(=CC=C1C[C@H](C(=O)O)N)C#N
Synonyms:
  • 4-Cyano-D-phenylalanine
  • (2R)-2-Amino-3-(4-cyanophenyl)propanoic acid
  • H-D-Phe(4-CN)-OH
Found 3 products.