CymitQuimica logo

CAS 263399-35-5

:

(9Z)-12,13-Dihydroxy-9-octadecenoic acid

Description:
(9Z)-12,13-Dihydroxy-9-octadecenoic acid, commonly referred to as a type of hydroxy fatty acid, is characterized by its long carbon chain and the presence of two hydroxyl (-OH) groups at the 12th and 13th positions, along with a cis double bond at the 9th position. This compound is derived from oleic acid and is notable for its potential biological activities, including anti-inflammatory and antimicrobial properties. The presence of hydroxyl groups enhances its solubility in water compared to typical fatty acids, which can influence its reactivity and interactions in biological systems. It is often studied in the context of lipid metabolism and may play a role in various physiological processes. The compound's structure allows it to participate in various chemical reactions, making it of interest in both biochemical research and potential therapeutic applications. As with many fatty acids, its behavior can be influenced by factors such as pH, temperature, and the presence of other molecules.
Formula:C18H34O4
InChI:InChI=1/C18H34O4/c1-2-3-10-13-16(19)17(20)14-11-8-6-4-5-7-9-12-15-18(21)22/h8,11,16-17,19-20H,2-7,9-10,12-15H2,1H3,(H,21,22)/b11-8-
InChI key:InChIKey=CQSLTKIXAJTQGA-FLIBITNWNA-N
SMILES:C(C/C=C\CCCCCCCC(O)=O)(C(CCCCC)O)O
Synonyms:
  • 12,13-DHOME
  • 9-Octadecenoic acid, 12,13-dihydroxy-, (9Z)-
  • 12,13-DiHOME
  • (9Z)-12,13-Dihydroxy-9-octadecenoic acid
Found 5 products.