CAS 26351-19-9

Violuric acid monohydrate

Description:

Violuric acid monohydrate is an organic compound characterized by its unique structure and properties. It is a derivative of violuric acid, which is known for its role in dye chemistry, particularly in the synthesis of azo dyes. The monohydrate form indicates that it contains one molecule of water associated with each molecule of the acid, which can influence its solubility and stability. Violuric acid monohydrate typically appears as a crystalline solid and is soluble in water, making it useful in various applications, including analytical chemistry and dye manufacturing. The compound features functional groups that contribute to its reactivity, allowing it to participate in various chemical reactions, such as condensation and coupling reactions. Its CAS number, 26351-19-9, is a unique identifier that facilitates the identification and study of this substance in scientific literature and databases. Overall, violuric acid monohydrate is significant in both industrial and research contexts due to its chemical properties and applications.

Formula: C₄H₅N₃O₅

InChI: InChI=1/C4H3N3O4.H2O/c8-2-1(7-11)3(9)6-4(10)5-2;/h11H,(H2,5,6,8,9,10);1H2

SMILES: C1(=NO)C(=NC(=O)N=C1O)O.O

Synonyms:

• Alloxan-5-oxime monohydrate
• 5-Isonitrosobarbituric acid monohydrate
• 5-(hydroxyimino)pyrimidine-2,4,6(1H,3H,5H)-trione hydrate (1:1)

Violuric acid monohydrate, 97%

CAS: 26351-19-9

Violuric acid monohydrate is used as a reagent for cobalt. It is also used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Al

Formula: C₄H₅N₃O₅

Purity: 97%

Color and Shape: Powder, White to pale cream to cream to yellow

Molecular weight: 175.10

Ref: 02-B23931

5-(Hydroxyimino)pyrimidine-2,4,6(1H,3H,5H)-trione hydrate

CAS: 26351-19-9

Formula: C₄H₅N₃O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 175.0996

Ref: IN-DA002SVF

Violuric Acid Monohydrate

CAS: 26351-19-9

Violuric Acid Monohydrate

Purity: 98%

Molecular weight: 175.1g/mol

Ref: 54-OR1029286

5-(Hydroxyimino)pyrimidine-2,4,6(1H,3H,5H)-trione hydrate

CAS: 26351-19-9

Formula: C₄H₅N₃O₅

Purity: 98%+(HPLC);RG

Molecular weight: 175.1

Ref: 10-F323354