CAS 26351-19-9
:Violuric acid monohydrate
Description:
Violuric acid monohydrate is an organic compound characterized by its unique structure and properties. It is a derivative of violuric acid, which is known for its role in dye chemistry, particularly in the synthesis of azo dyes. The monohydrate form indicates that it contains one molecule of water associated with each molecule of the acid, which can influence its solubility and stability. Violuric acid monohydrate typically appears as a crystalline solid and is soluble in water, making it useful in various applications, including analytical chemistry and dye manufacturing. The compound features functional groups that contribute to its reactivity, allowing it to participate in various chemical reactions, such as condensation and coupling reactions. Its CAS number, 26351-19-9, is a unique identifier that facilitates the identification and study of this substance in scientific literature and databases. Overall, violuric acid monohydrate is significant in both industrial and research contexts due to its chemical properties and applications.
Formula:C4H5N3O5
InChI:InChI=1/C4H3N3O4.H2O/c8-2-1(7-11)3(9)6-4(10)5-2;/h11H,(H2,5,6,8,9,10);1H2
SMILES:C1(=NO)C(=NC(=O)N=C1O)O.O
Synonyms:- Alloxan-5-oxime monohydrate
- 5-Isonitrosobarbituric acid monohydrate
- 5-(hydroxyimino)pyrimidine-2,4,6(1H,3H,5H)-trione hydrate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Violuric acid monohydrate, 97%
CAS:Violuric acid monohydrate is used as a reagent for cobalt. It is also used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original AlFormula:C4H5N3O5Purity:97%Color and Shape:Powder, White to pale cream to cream to yellowMolecular weight:175.10Violuric Acid Monohydrate
CAS:Violuric Acid MonohydrateFormula:C4H5N3O5Purity:98%Molecular weight:175.15-(Hydroxyimino)pyrimidine-2,4,6(1H,3H,5H)-trione hydrate
CAS:Formula:C4H5N3O5Purity:98%Color and Shape:SolidMolecular weight:175.09965-(Hydroxyimino)pyrimidine-2,4,6(1H,3H,5H)-trione hydrate
CAS:Formula:C4H5N3O5Purity:98%+(HPLC);RGMolecular weight:175.1



