CymitQuimica logo

CAS 2637-75-4

:

ethyl 1-acetylpiperidine-3-carboxylate

Description:
Ethyl 1-acetylpiperidine-3-carboxylate is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an ethyl ester functional group and an acetyl group, contributing to its reactivity and solubility properties. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. Ethyl 1-acetylpiperidine-3-carboxylate is known for its potential applications in medicinal chemistry, particularly in the synthesis of various pharmaceuticals and biologically active compounds. Its molecular structure allows for diverse chemical reactions, including acylation and esterification. The compound is generally soluble in organic solvents such as ethanol and dichloromethane, while its solubility in water is limited. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper laboratory practices should be followed when working with this substance to ensure safety and compliance with regulations.
Formula:C10H17NO3
InChI:InChI=1/C10H17NO3/c1-3-14-10(13)9-5-4-6-11(7-9)8(2)12/h9H,3-7H2,1-2H3
InChI key:QPSYWOLGKVKKHD-UHFFFAOYSA-N
SMILES:CCOC(=O)C1CCCN(C1)C(=O)C
Synonyms:
  • 3-Piperidinecarboxylic Acid, 1-Acetyl-, Ethyl Ester
Found 2 products.