CymitQuimica logo

CAS 263717-53-9

:

Propyl pyrazole triol

Description:
Propyl pyrazole triol, identified by its CAS number 263717-53-9, is a chemical compound characterized by its unique structure that includes a pyrazole ring and three hydroxyl (–OH) groups. This compound is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to interact with biological systems. The presence of multiple hydroxyl groups enhances its solubility in polar solvents and may contribute to its reactivity and ability to form hydrogen bonds. Additionally, the pyrazole moiety can influence its biological activity, making it a subject of interest in medicinal chemistry. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on its formulation and the conditions under which it is studied. As with many chemical substances, safety and handling precautions are essential, given the potential for toxicity or reactivity in certain environments. Further research is often necessary to fully elucidate its characteristics and applications in various scientific domains.
Formula:C24H22N2O3
InChI:InChI=1S/C24H22N2O3/c1-2-3-22-23(16-4-10-19(27)11-5-16)25-26(18-8-14-21(29)15-9-18)24(22)17-6-12-20(28)13-7-17/h4-15,27-29H,2-3H2,1H3
InChI key:InChIKey=IOTXSIGGFRQYKW-UHFFFAOYSA-N
SMILES:C(CC)C1=C(N(N=C1C2=CC=C(O)C=C2)C3=CC=C(O)C=C3)C4=CC=C(O)C=C4
Synonyms:
  • 1,3,5-tris(4-hydroxyphenyl)-4-propyl-1H-pyrazole
  • 4,4′,4′′-(4-Propyl-1H-pyrazole-1,3,5-triyl)tris[phenol]
  • Phenol, 4,4',4''-(4-propyl-1H-pyrazole-1,3,5-triyl)tris-
  • Phenol, 4,4′,4′′-(4-propyl-1H-pyrazole-1,3,5-triyl)tris-
  • Propyl pyrazole triol
  • PPT
  • 4,4',4''-(4-Propyl-1H-pyrazole-1,3,5-triyl)triphenol
Found 9 products.