CymitQuimica logo

CAS 263874-05-1

:

1,1'-pyridine-2,6-diylbis(3-methyl-1H-imidazol-3-ium) dibromide

Description:
1,1'-Pyridine-2,6-diylbis(3-methyl-1H-imidazol-3-ium) dibromide is a complex organic compound characterized by its unique structure, which includes a pyridine moiety and two 3-methyl-1H-imidazolium units. This compound typically exhibits properties associated with ionic liquids, such as low volatility and high thermal stability. The presence of bromide ions contributes to its ionic character, enhancing solubility in polar solvents. The imidazolium groups can participate in various chemical reactions, making this compound potentially useful in catalysis and as a precursor for other functional materials. Additionally, the pyridine ring may impart basicity and coordination properties, allowing for interactions with metal ions or other substrates. Overall, this compound's structural features suggest applications in fields such as organic synthesis, materials science, and electrochemistry, where its ionic nature and functional groups can be leveraged for specific chemical processes.
Formula:C13H15Br2N5
InChI:InChI=1/C13H15N5.2BrH/c1-15-6-8-17(10-15)12-4-3-5-13(14-12)18-9-7-16(2)11-18;;/h3-11H,1-2H3;2*1H/q+2;;/p-2
InChI key:VAESRVWVZJLVIA-UHFFFAOYSA-L
SMILES:C[N+]1=CN(C=C1)C2=NC(=CC=C2)N3C=C[N+](=C3)C.[Br-].[Br-]
Found 5 products.