CAS 2643-38-1

1,1'-[sulfonylbis(1-bromoethane-2,1-diyl)]dibenzene

Description:

1,1'-[Sulfonylbis(1-bromoethane-2,1-diyl)]dibenzene, with the CAS number 2643-38-1, is an organic compound characterized by its complex structure that includes a sulfonyl group and two brominated ethane units linked to a dibenzene framework. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential reactivity due to the presence of bromine atoms, which can participate in nucleophilic substitution reactions. The sulfonyl group contributes to the compound's polarity and solubility in polar solvents, while the dibenzene moiety enhances its stability and aromatic character. The presence of bromine also suggests potential applications in organic synthesis and materials science, particularly in the development of polymers or as intermediates in chemical reactions. Overall, this compound's unique structure and functional groups make it of interest in various chemical applications, including medicinal chemistry and materials development.

Formula: C₁₆H₁₆Br₂O₂S

InChI: InChI=1/C16H16Br2O2S/c17-15(13-7-3-1-4-8-13)11-21(19,20)12-16(18)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2

InChI key: DGFZIVSUZAVFBF-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)C(CS(=O)(=O)CC(C2=CC=CC=C2)Br)Br

Benzene, 1,1'-[sulfonylbis(1-bromo-2,1-ethanediyl)]bis- (9CI)

CAS: 2643-38-1

Formula: C₁₆H₁₆Br₂O₂S

Molecular weight: 432.17

Ref: IN-DA002T70