CAS 2646-91-5
:2,3-Difluorobenzaldehyde
Description:
2,3-Difluorobenzaldehyde is an aromatic aldehyde characterized by the presence of two fluorine atoms positioned at the 2 and 3 positions of the benzene ring relative to the aldehyde functional group. Its molecular formula is C7H4F2O, and it features a distinctive structure that influences its chemical properties and reactivity. This compound typically appears as a colorless to pale yellow liquid with a characteristic aromatic odor. It is known for its moderate volatility and can be soluble in organic solvents such as ethanol and ether, while being less soluble in water. The presence of fluorine atoms enhances its electrophilic character, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 2,3-difluorobenzaldehyde can participate in various chemical reactions, including nucleophilic additions and condensation reactions, due to the reactivity of the aldehyde group. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C7H4F2O
InChI:InChI=1S/C7H4F2O/c8-6-3-1-2-5(4-10)7(6)9/h1-4H
InChI key:InChIKey=WDBAXYQUOZDFOJ-UHFFFAOYSA-N
SMILES:C(=O)C1=C(F)C(F)=CC=C1
Synonyms:- 2,2',3,3',5,5',6,6'-Octafluoro-4,4'-Dimethylbiphenyl
- 2,3-Difluorbenzolcarbaldehyd
- Benzaldehyde, 2,3-difluoro-
- Vhr Bf Cf
- 2,3-Difluorobenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Benzaldehyde, 2,3-difluoro-
CAS:Formula:C7H4F2OPurity:98%Color and Shape:LiquidMolecular weight:142.1029Ref: IN-DA002TBS
1kgTo inquire1g22.00€5g24.00€10g31.00€25g53.00€50g78.00€100g117.00€250g201.00€500g363.00€2,3-Difluorobenzaldehyde
CAS:2,3-DifluorobenzaldehydeFormula:C7H4F2OPurity:98%Color and Shape:Colourless to pale yellow. Liquid-ClearMolecular weight:142.102862,3-Difluorobenzaldehyde
CAS:Formula:C7H4F2OPurity:>97.0%(GC)Color and Shape:Colorless to Yellow clear liquidMolecular weight:142.102,3-Difluorobenzaldehyde
CAS:2,3-Difluorobenzaldehyde is a heterocyclic compound that has been shown to inhibit the activity of LP-PLA2. It also has proton and chloride ions as its reactive intermediates, which are generated from ethylene diamine in the reaction mechanism. 2,3-Difluorobenzaldehyde has been used in clinical trials for cancer, inflammatory diseases, and other conditions. This molecule does not react with fatty acids and is not metabolized by cytochrome P450 enzymes.Formula:C7H4F2OPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:142.1 g/mol






