CAS 26476-16-4
:2-(1H-tetrazol-1-yl)acetamide
Description:
2-(1H-tetrazol-1-yl)acetamide, with the CAS number 26476-16-4, is a chemical compound characterized by the presence of a tetrazole ring, which is a five-membered aromatic ring containing four nitrogen atoms and one carbon atom. This compound features an acetamide functional group, indicating that it has both amide and acetic acid characteristics. It is typically a white to off-white solid and is soluble in polar solvents, which is common for compounds containing nitrogen-rich heterocycles. The tetrazole moiety contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly for its role in drug design and development. The compound may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on its structure-activity relationship. Additionally, its stability and reactivity can be influenced by the presence of the tetrazole ring, which can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions.
Formula:C3H5N5O
InChI:InChI=1/C3H5N5O/c4-3(9)1-8-2-5-6-7-8/h2H,1H2,(H2,4,9)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
