CAS 26495-91-0
:N-[(Triethoxysilyl)methyl]cyclohexanamine
Description:
N-[(Triethoxysilyl)methyl]cyclohexanamine, with the CAS number 26495-91-0, is an organosilicon compound characterized by the presence of a triethoxysilyl group attached to a cyclohexanamine moiety. This compound typically exhibits properties associated with both amines and silanes, making it useful in various applications, particularly in surface modification and adhesion. The triethoxysilyl group allows for chemical bonding to siliceous surfaces, enhancing the adhesion of coatings, sealants, and composites. The cyclohexanamine structure contributes to its stability and reactivity, providing potential for further functionalization. In terms of solubility, it is generally soluble in organic solvents, while its silane component can hydrolyze in the presence of moisture, leading to the formation of silanol groups that can further react with surfaces. This compound is often utilized in the formulation of advanced materials, including those used in the automotive and construction industries, due to its ability to improve mechanical properties and durability. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.
Formula:C13H29NO3Si
InChI:InChI=1S/C13H29NO3Si/c1-4-15-18(16-5-2,17-6-3)12-14-13-10-8-7-9-11-13/h13-14H,4-12H2,1-3H3
InChI key:InChIKey=WUFHQGLVNNOXMP-UHFFFAOYSA-N
SMILES:[Si](CNC1CCCCC1)(OCC)(OCC)OCC
Synonyms:- Cyclohexanamine, N-((triethoxysilyl)methyl)-
- Cyclohexylamine, N-[(triethoxysilyl)methyl]-
- Geniosil XL 926
- N-Cyclohexyl(aminomethyl)triethoxysilane
- N-[(triethoxysilyl)methyl]cyclohexanamine
- Sic 2464.2
- [(Cyclohexylamino)methyl]triethoxysilane
- N-((Triethoxysilyl)methyl)cyclohexylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
