CymitQuimica logo

CAS 26518-71-8

:

6-acetyl-2H-1,4-benzoxazin-3(4H)-one

Description:
6-Acetyl-2H-1,4-benzoxazin-3(4H)-one, with the CAS number 26518-71-8, is a chemical compound that belongs to the class of benzoxazines, which are characterized by a fused benzene and oxazine ring structure. This compound typically exhibits a pale yellow to light brown solid appearance and is known for its potential biological activities, including antimicrobial and antioxidant properties. It features an acetyl group at the 6-position, which contributes to its reactivity and solubility in organic solvents. The presence of the oxazine ring imparts unique chemical properties, making it a subject of interest in various fields, including medicinal chemistry and materials science. Its synthesis often involves the condensation of appropriate precursors, and it may undergo further reactions such as hydrolysis or substitution. Due to its structural characteristics, 6-acetyl-2H-1,4-benzoxazin-3(4H)-one can participate in various chemical reactions, making it a versatile compound for research and application in developing new materials or pharmaceuticals.
Formula:C10H9NO3
InChI:InChI=1/C10H9NO3/c1-6(12)7-2-3-9-8(4-7)11-10(13)5-14-9/h2-4H,5H2,1H3,(H,11,13)
InChI key:BKJFWHFUERNXLJ-UHFFFAOYSA-N
SMILES:CC(=O)c1ccc2c(c1)N=C(CO2)O
Found 6 products.