CymitQuimica logo

CAS 26518-76-3

:

6-(chloroacetyl)-2H-1,4-benzoxazin-3(4H)-one

Description:
6-(Chloroacetyl)-2H-1,4-benzoxazin-3(4H)-one is a chemical compound characterized by its unique structure, which includes a benzoxazine ring fused with a chloroacetyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. It is often studied for its applications in medicinal chemistry, particularly due to its potential as a scaffold for drug development. The presence of the chloroacetyl group may enhance its reactivity, making it a useful intermediate in organic synthesis. Additionally, the compound may display various physical properties such as solubility in organic solvents, and its stability can be influenced by environmental factors like temperature and pH. As with many chemical substances, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, 6-(chloroacetyl)-2H-1,4-benzoxazin-3(4H)-one represents a significant compound in the realm of organic and medicinal chemistry.
Formula:C10H8ClNO3
InChI:InChI=1/C10H8ClNO3/c11-4-8(13)6-1-2-9-7(3-6)12-10(14)5-15-9/h1-3H,4-5H2,(H,12,14)
InChI key:MIAHXWVABDHISZ-UHFFFAOYSA-N
SMILES:c1cc2c(cc1C(=O)CCl)N=C(CO2)O
Found 5 products.