CymitQuimica logo

CAS 26543-05-5

:

(2S)-3-hydroxy-2-methylpropanoic acid

Description:
(2S)-3-hydroxy-2-methylpropanoic acid, also known as L-threonine, is an α-amino acid that plays a crucial role in protein synthesis. It is characterized by its chiral center, which gives rise to its specific stereochemistry, denoted by the (2S) configuration. This compound features a hydroxyl group (-OH) attached to the third carbon of the propanoic acid backbone, contributing to its classification as a hydroxy acid. L-threonine is polar and hydrophilic due to the presence of both the hydroxyl and carboxylic acid functional groups, which allows it to participate in hydrogen bonding. It is soluble in water and has a relatively high melting point compared to non-polar amino acids. L-threonine is essential for humans, meaning it must be obtained through the diet, and it is involved in various metabolic processes, including the synthesis of proteins and the production of other biomolecules. Additionally, it is utilized in various industrial applications, including pharmaceuticals and animal feed.
Formula:C4H8O3
InChI:InChI=1/C4H8O3/c1-3(2-5)4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m0/s1
InChI key:DBXBTMSZEOQQDU-VKHMYHEASA-N
SMILES:C[C@@H](CO)C(=O)O
Synonyms:
  • 3-Hydroxy-2-methylpropanoic acid
  • (S)-3-Hydroxy-2-Methyl-Propanoic Acid
  • (S)-beta-Hydroxyisobutyric acid
  • (S)-b-Hydroxyisobutyric acid
  • propanoic acid, 3-hydroxy-2-methyl-, (2S)-
Found 3 products.