CymitQuimica logo

CAS 265646-85-3

:

Urea,N-[3,5-bis(trifluoromethyl)phenyl]-N'-[4-bromo-2-(1H-tetrazol-5-yl)phenyl]-

Description:
Urea, N-[3,5-bis(trifluoromethyl)phenyl]-N'-[4-bromo-2-(1H-tetrazol-5-yl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a urea moiety linked to two distinct aromatic groups. The presence of trifluoromethyl groups enhances its lipophilicity and may influence its biological activity, while the bromine atom and the tetrazole ring contribute to its potential as a pharmacophore in medicinal chemistry. This compound is likely to exhibit interesting chemical properties, such as stability under various conditions, and may participate in hydrogen bonding due to the urea functional group. Its unique structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's solubility and reactivity can be influenced by the presence of the halogen and the heterocyclic tetrazole, making it a subject of interest for further research in both organic synthesis and pharmaceutical applications. Safety and handling precautions should be observed due to the presence of halogens and the potential biological activity of the compound.
Formula:C16H9BrF6N6O
InChI:InChI=1S/C16H9BrF6N6O/c17-9-1-2-11(13-26-28-29-27-13)12(6-9)25-14(30)24-10-4-7(15(18,19)20)3-8(5-10)16(21,22)23/h1-6H,(H2,24,25,30)(H,26,27,28,29)
InChI key:OQRAKHDEGGGWQO-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1Br)NC(=O)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)C3=NNN=N3
Found 7 products.