CymitQuimica logo

CAS 26575-93-9

:

Alisol C Monoacetate

Description:
Alisol C Monoacetate, with the CAS number 26575-93-9, is a chemical compound derived from the natural product alisol C, which is found in the rhizomes of certain plants, particularly those in the genus Alisma. This compound is characterized by its structural features, which include a steroid-like framework with specific functional groups that contribute to its biological activity. Alisol C Monoacetate is known for its potential pharmacological properties, including anti-inflammatory and hepatoprotective effects. It is often studied for its role in traditional medicine and its potential applications in modern therapeutics. The compound is typically a white to off-white solid and is soluble in organic solvents, which makes it suitable for various chemical reactions and formulations. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As research continues, Alisol C Monoacetate may reveal further insights into its mechanisms of action and potential uses in health and medicine.
Formula:C32H48O6
InChI:InChI=1S/C32H48O6/c1-17(14-22(37-18(2)33)27-29(5,6)38-27)25-19-15-20(34)26-30(7)12-11-24(36)28(3,4)23(30)10-13-31(26,8)32(19,9)16-21(25)35/h17,20,22-23,26-27,34H,10-16H2,1-9H3/t17-,20+,22+,23+,26+,27-,30+,31+,32+/m1/s1
InChI key:KOOCQNIPRJEMDH-QSKXMHMESA-N
SMILES:C[C@H](C[C@@H]([C@@H]1C(O1)(C)C)OC(=O)C)C2=C3C[C@@H]([C@H]4[C@]5(CCC(=O)C([C@@H]5CC[C@@]4([C@]3(CC2=O)C)C)(C)C)C)O
Found 5 products.