CymitQuimica logo

CAS 26586-26-5

:

3-nitro-4-piperidin-1-ylbenzoic acid

Description:
3-Nitro-4-piperidin-1-ylbenzoic acid is an organic compound characterized by its structure, which includes a benzoic acid moiety substituted with a nitro group and a piperidine ring. The presence of the nitro group typically imparts polar characteristics, influencing the compound's solubility and reactivity. The piperidine ring, a six-membered nitrogen-containing heterocycle, contributes to the compound's basicity and potential interactions with biological systems. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for potential hydrogen bonding due to the carboxylic acid group, which can enhance solubility in polar solvents. Additionally, the compound's unique combination of functional groups may lead to specific interactions with biological targets, making it a candidate for further research in drug development. Overall, 3-nitro-4-piperidin-1-ylbenzoic acid is notable for its structural complexity and potential applications in various chemical and pharmaceutical contexts.
Formula:C12H14N2O4
InChI:InChI=1/C12H14N2O4/c15-12(16)9-4-5-10(11(8-9)14(17)18)13-6-2-1-3-7-13/h4-5,8H,1-3,6-7H2,(H,15,16)
InChI key:YVODCTHEVCBRCV-UHFFFAOYSA-N
SMILES:C1CCN(CC1)c1ccc(cc1N(=O)=O)C(=O)O
Synonyms:
  • 3-Nitro-4-(piperidin-1-yl)benzoic acid
  • Benzoic acid, 3-nitro-4-(1-piperidinyl)-
Found 3 products.