CymitQuimica logo

CAS 26681-88-9

:

Divinylphenylphosphine

Description:
Divinylphenylphosphine, with the CAS number 26681-88-9, is an organophosphorus compound characterized by the presence of both vinyl and phenyl groups attached to a phosphorus atom. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the vinyl groups, which can participate in various polymerization reactions. Divinylphenylphosphine is often utilized in organic synthesis and materials science, particularly in the development of phosphine-based ligands for catalysis and in the production of specialty polymers. Its chemical structure allows for the formation of cross-linked networks, making it valuable in applications requiring durable materials. Additionally, the compound exhibits properties typical of phosphines, such as being a Lewis base, which can coordinate with metal centers in catalytic processes. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be employed in laboratory settings.
Formula:C10H11P
InChI:InChI=1S/C10H11P/c1-3-11(4-2)10-8-6-5-7-9-10/h3-9H,1-2H2
InChI key:InChIKey=GEKAWPIATFUQJW-UHFFFAOYSA-N
SMILES:P(C=C)(C=C)C1=CC=CC=C1
Synonyms:
  • Phenyldivinylphosphine
  • Phosphine, phenyldivinyl-
  • Diethenylphenylphosphine
  • Phosphine, diethenylphenyl-
  • Divinylphenylphosphine
Found 2 products.