CAS 2693-57-4
:4-amino-3-chloro-2,5,6-trifluoro-pyridine
Description:
4-Amino-3-chloro-2,5,6-trifluoro-pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted with an amino group, a chlorine atom, and three fluorine atoms at specific positions. The presence of the amino group (-NH2) contributes to its basicity and potential reactivity, while the chlorine and fluorine substituents enhance its electrophilic character and influence its physical properties, such as solubility and boiling point. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its unique combination of halogen and amino functionalities makes it of interest in various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate in the synthesis of more complex molecules. Additionally, the trifluoromethyl groups can impart unique electronic properties, making it a valuable compound for research and development in medicinal chemistry. Safety precautions should be taken when handling this compound due to its potential toxicity and reactivity.
Formula:C5H2ClF3N2
InChI:InChI=1/C5H2ClF3N2/c6-1-3(10)2(7)5(9)11-4(1)8/h(H2,10,11)
SMILES:c1(c(c(c(F)nc1F)F)N)Cl
Synonyms:- 4-Amino-3-chloro-2,5,6-trifluoropyridine
- 3-Chloro-2,5,6-Trifluoropyridin-4-Amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Amino-3-chloro-2,5,6-trifluoropyridine
CAS:4-Amino-3-chloro-2,5,6-trifluoropyridineFormula:C5H2ClF3N2Purity:95%Color and Shape:Solid-PowderMolecular weight:182.530984-Amino-3-chloro-2,5,6-trifluoropyridine
CAS:Formula:C5H2ClF3N2Color and Shape:SolidMolecular weight:182.53104-Amino-3-chloro-2,5,6-trifluoropyridine
CAS:4-Amino-3-chloro-2,5,6-trifluoropyridine is a reactive and unstable chemical compound that belongs to the group of anilines. It is used in the synthesis of hypsochromic dyes. The compound has been shown to interact with other molecules, such as chemo-, supramolecular-, and synthetically-. The fluorophore has been stabilized by a supramolecular approach. Chemically induced fluorescence properties have been observed for 4-amino-3-chloro-2,5,6-trifluoropyridine.Formula:C5H2ClF3N2Purity:Min. 95%Color and Shape:SolidMolecular weight:182.53 g/mol



