CymitQuimica logo

CAS 269390-69-4

:

Benzamide,N-(4-chlorophenyl)-2-[(4-pyridinylmethyl)amino]-

Description:
Benzamide, N-(4-chlorophenyl)-2-[(4-pyridinylmethyl)amino]- is a chemical compound characterized by its complex structure, which includes a benzamide moiety and a pyridine ring. The presence of a 4-chlorophenyl group indicates that it has a chlorine substituent on the phenyl ring, which can influence its reactivity and biological activity. The compound features an amino group linked to a pyridine, suggesting potential interactions in biological systems, particularly in medicinal chemistry. This compound may exhibit properties such as solubility in organic solvents and varying degrees of polarity, influenced by its functional groups. Its molecular structure allows for potential applications in pharmaceuticals, particularly as a lead compound in drug development targeting specific biological pathways. Additionally, the presence of both aromatic and heterocyclic components may contribute to its stability and reactivity. As with many compounds, safety and handling precautions should be observed, given the potential for biological activity and toxicity associated with chlorinated aromatic compounds.
Formula:C19H16ClN3O
InChI:InChI=1S/C19H16ClN3O/c20-15-5-7-16(8-6-15)23-19(24)17-3-1-2-4-18(17)22-13-14-9-11-21-12-10-14/h1-12,22H,13H2,(H,23,24)
InChI key:GGPZCOONYBPZEW-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)Cl)NCC3=CC=NC=C3
Synonyms:
  • N-(4-Chlorophenyl)-2-[(Pyridin-4-Ylmethyl)Amino]Benzamide
  • Vegf Receptor Tyrosine Kinase Inhibitor Ii
Found 4 products.